About [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate
[(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate (PubChem CID 10582504) has the molecular formula C13H22O5
and a molecular weight of 258.31 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate |
| PubChem CID | 10582504 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate |
| SMILES | CC(C)=CC(=O)OC[C@H](CO)OC(=O)CC(C)C |
| InChI | InChI=1S/C13H22O5/c1-9(2)5-12(15)17-8-11(7-14)18-13(16)6-10(3)4/h5,10-11,14H,6-8H2,1-4H3/t11-/m0/s1 |
| InChIKey | RCWWDGYRVMTSSO-NSHDSACASA-N |
| XLogP | 1.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate?
The IUPAC name of [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate (CID 10582504) is [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate.
What is the SMILES notation for [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate?
The canonical SMILES for [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate is CC(C)=CC(=O)OC[C@H](CO)OC(=O)CC(C)C.
What is the InChIKey of [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate?
The InChIKey is RCWWDGYRVMTSSO-NSHDSACASA-N. The full InChI is InChI=1S/C13H22O5/c1-9(2)5-12(15)17-8-11(7-14)18-13(16)6-10(3)4/h5,10-11,14H,6-8H2,1-4H3/t11-/m0/s1.
What are the key properties of [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate?
[(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate has a molecular weight of 258.31 g/mol, XLogP of 1.45, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-hydroxy-3-(3-methylbut-2-enoyloxy)propan-2-yl] 3-methylbutanoate is sourced from PubChem (CID 10582504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).