C21H23N5O3 — CID 10582624
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-pteridine-2,4-dione (PubChem CID 10582624) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-pteridine-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 10582624 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-1H-pteridine-2,4-dione |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCn3c(=O)[nH]c4nccnc4c3=O)C[C@@H]21 |
| InChI | InChI=1S/C21H23N5O3/c1-29-17-4-2-3-14-15(17)6-5-13-11-25(12-16(13)14)9-10-26-20(27)18-19(24-21(26)28)23-8-7-22-18/h2-4,7-8,13,16H,5-6,9-12H2,1H3,(H,23,24,28)/t13-,16+/m0/s1 |
| InChIKey | HTYVDYLLKXEKSL-XJKSGUPXSA-N |
| XLogP | 1.15 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |