About 3-methyl-2H-pyrazolo[3,4-b]pyridine
3-methyl-2H-pyrazolo[3,4-b]pyridine (PubChem CID 10582825) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 3-methyl-2H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-methyl-2H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 10582825 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 3-methyl-2H-pyrazolo[3,4-b]pyridine |
| SMILES | Cc1[nH]nc2ncccc12 |
| InChI | InChI=1S/C7H7N3/c1-5-6-3-2-4-8-7(6)10-9-5/h2-4H,1H3,(H,8,9,10) |
| InChIKey | STHBHEYNLYNJAM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 3-methyl-2H-pyrazolo[3,4-b]pyridine (CID 10582825) is 3-methyl-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3-methyl-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3-methyl-2H-pyrazolo[3,4-b]pyridine is Cc1[nH]nc2ncccc12.
What is the InChIKey of 3-methyl-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is STHBHEYNLYNJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-5-6-3-2-4-8-7(6)10-9-5/h2-4H,1H3,(H,8,9,10).
What are the key properties of 3-methyl-2H-pyrazolo[3,4-b]pyridine?
3-methyl-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 133.15 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 10582825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).