About methyl N-[(1Z)-penta-1,4-dienyl]carbamate
methyl N-[(1Z)-penta-1,4-dienyl]carbamate (PubChem CID 10582874) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is methyl N-[(1Z)-penta-1,4-dienyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(1Z)-penta-1,4-dienyl]carbamate |
| PubChem CID | 10582874 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | methyl N-[(1Z)-penta-1,4-dienyl]carbamate |
| SMILES | C=CC/C=C\NC(=O)OC |
| InChI | InChI=1S/C7H11NO2/c1-3-4-5-6-8-7(9)10-2/h3,5-6H,1,4H2,2H3,(H,8,9)/b6-5- |
| InChIKey | FJVLLMGGTAFFOP-WAYWQWQTSA-N |
| XLogP | 1.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(1Z)-penta-1,4-dienyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(1Z)-penta-1,4-dienyl]carbamate?
The IUPAC name of methyl N-[(1Z)-penta-1,4-dienyl]carbamate (CID 10582874) is methyl N-[(1Z)-penta-1,4-dienyl]carbamate.
What is the SMILES notation for methyl N-[(1Z)-penta-1,4-dienyl]carbamate?
The canonical SMILES for methyl N-[(1Z)-penta-1,4-dienyl]carbamate is C=CC/C=C\NC(=O)OC.
What is the InChIKey of methyl N-[(1Z)-penta-1,4-dienyl]carbamate?
The InChIKey is FJVLLMGGTAFFOP-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H11NO2/c1-3-4-5-6-8-7(9)10-2/h3,5-6H,1,4H2,2H3,(H,8,9)/b6-5-.
What are the key properties of methyl N-[(1Z)-penta-1,4-dienyl]carbamate?
methyl N-[(1Z)-penta-1,4-dienyl]carbamate has a molecular weight of 141.17 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(1Z)-penta-1,4-dienyl]carbamate is sourced from PubChem (CID 10582874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).