About 7-methoxyfuro[2,3-c]pyridine
7-methoxyfuro[2,3-c]pyridine (PubChem CID 10582930) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 7-methoxyfuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-methoxyfuro[2,3-c]pyridine |
| PubChem CID | 10582930 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 7-methoxyfuro[2,3-c]pyridine |
| SMILES | COc1nccc2ccoc12 |
| InChI | InChI=1S/C8H7NO2/c1-10-8-7-6(2-4-9-8)3-5-11-7/h2-5H,1H3 |
| InChIKey | DVILKHNLGIDKHW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxyfuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyfuro[2,3-c]pyridine?
The IUPAC name of 7-methoxyfuro[2,3-c]pyridine (CID 10582930) is 7-methoxyfuro[2,3-c]pyridine.
What is the SMILES notation for 7-methoxyfuro[2,3-c]pyridine?
The canonical SMILES for 7-methoxyfuro[2,3-c]pyridine is COc1nccc2ccoc12.
What is the InChIKey of 7-methoxyfuro[2,3-c]pyridine?
The InChIKey is DVILKHNLGIDKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c1-10-8-7-6(2-4-9-8)3-5-11-7/h2-5H,1H3.
What are the key properties of 7-methoxyfuro[2,3-c]pyridine?
7-methoxyfuro[2,3-c]pyridine has a molecular weight of 149.15 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyfuro[2,3-c]pyridine is sourced from PubChem (CID 10582930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).