About 2-(1H-pyrrol-2-yl)-1,3-thiazole
2-(1H-pyrrol-2-yl)-1,3-thiazole (PubChem CID 10582938) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-2-yl)-1,3-thiazole |
| PubChem CID | 10582938 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)-1,3-thiazole |
| SMILES | c1c[nH]c(-c2nccs2)c1 |
| InChI | InChI=1S/C7H6N2S/c1-2-6(8-3-1)7-9-4-5-10-7/h1-5,8H |
| InChIKey | PRALNEYHYQHWFN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-pyrrol-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-2-yl)-1,3-thiazole?
The IUPAC name of 2-(1H-pyrrol-2-yl)-1,3-thiazole (CID 10582938) is 2-(1H-pyrrol-2-yl)-1,3-thiazole.
What is the SMILES notation for 2-(1H-pyrrol-2-yl)-1,3-thiazole?
The canonical SMILES for 2-(1H-pyrrol-2-yl)-1,3-thiazole is c1c[nH]c(-c2nccs2)c1.
What is the InChIKey of 2-(1H-pyrrol-2-yl)-1,3-thiazole?
The InChIKey is PRALNEYHYQHWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c1-2-6(8-3-1)7-9-4-5-10-7/h1-5,8H.
What are the key properties of 2-(1H-pyrrol-2-yl)-1,3-thiazole?
2-(1H-pyrrol-2-yl)-1,3-thiazole has a molecular weight of 150.21 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-2-yl)-1,3-thiazole is sourced from PubChem (CID 10582938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).