About N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine
N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine (PubChem CID 10582965) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine |
| PubChem CID | 10582965 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine |
| SMILES | ONC[C@@H]1C[C@H]1c1ccoc1 |
| InChI | InChI=1S/C8H11NO2/c10-9-4-7-3-8(7)6-1-2-11-5-6/h1-2,5,7-10H,3-4H2/t7-,8-/m0/s1 |
| InChIKey | MEPMSSPCPXHVTO-YUMQZZPRSA-N |
| XLogP | 1.36 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine?
The IUPAC name of N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine (CID 10582965) is N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine.
What is the SMILES notation for N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine?
The canonical SMILES for N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine is ONC[C@@H]1C[C@H]1c1ccoc1.
What is the InChIKey of N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine?
The InChIKey is MEPMSSPCPXHVTO-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H11NO2/c10-9-4-7-3-8(7)6-1-2-11-5-6/h1-2,5,7-10H,3-4H2/t7-,8-/m0/s1.
What are the key properties of N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine?
N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine has a molecular weight of 153.18 g/mol, XLogP of 1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,2R)-2-(furan-3-yl)cyclopropyl]methyl]hydroxylamine is sourced from PubChem (CID 10582965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).