About (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile
(2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile (PubChem CID 10582967) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile |
| PubChem CID | 10582967 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile |
| SMILES | COC(/C=C/C=C/C#N)OC |
| InChI | InChI=1S/C8H11NO2/c1-10-8(11-2)6-4-3-5-7-9/h3-6,8H,1-2H3/b5-3+,6-4+ |
| InChIKey | UPOSTHWLOJMLDT-GGWOSOGESA-N |
| XLogP | 1.24 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile?
The IUPAC name of (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile (CID 10582967) is (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile.
What is the SMILES notation for (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile?
The canonical SMILES for (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile is COC(/C=C/C=C/C#N)OC.
What is the InChIKey of (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile?
The InChIKey is UPOSTHWLOJMLDT-GGWOSOGESA-N. The full InChI is InChI=1S/C8H11NO2/c1-10-8(11-2)6-4-3-5-7-9/h3-6,8H,1-2H3/b5-3+,6-4+.
What are the key properties of (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile?
(2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile has a molecular weight of 153.18 g/mol, XLogP of 1.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-6,6-dimethoxyhexa-2,4-dienenitrile is sourced from PubChem (CID 10582967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).