C8H12O3 — CID 10583020
(1S,4S,5R,6S)-5-ethenyl-4-methyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 10583020) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (1S,4S,5R,6S)-5-ethenyl-4-methyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | (1S,4S,5R,6S)-5-ethenyl-4-methyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 10583020 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (1S,4S,5R,6S)-5-ethenyl-4-methyl-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | C=C[C@@]1(O)[C@H](C)OC[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C8H12O3/c1-3-8(9)5(2)10-4-6-7(8)11-6/h3,5-7,9H,1,4H2,2H3/t5-,6-,7-,8+/m0/s1 |
| InChIKey | ZBUPDNFWVZIBSE-DKXJUACHSA-N |
| XLogP | 0.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|