About deca-1,9-dien-4,6-diyne-3,8-diol
deca-1,9-dien-4,6-diyne-3,8-diol (PubChem CID 10583112) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is deca-1,9-dien-4,6-diyne-3,8-diol.
Molecular Properties
| Compound Name | deca-1,9-dien-4,6-diyne-3,8-diol |
| PubChem CID | 10583112 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | deca-1,9-dien-4,6-diyne-3,8-diol |
| SMILES | C=CC(O)C#CC#CC(O)C=C |
| InChI | InChI=1S/C10H10O2/c1-3-9(11)7-5-6-8-10(12)4-2/h3-4,9-12H,1-2H2 |
| InChIKey | SONJJNXBDNWCRX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze deca-1,9-dien-4,6-diyne-3,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deca-1,9-dien-4,6-diyne-3,8-diol?
The IUPAC name of deca-1,9-dien-4,6-diyne-3,8-diol (CID 10583112) is deca-1,9-dien-4,6-diyne-3,8-diol.
What is the SMILES notation for deca-1,9-dien-4,6-diyne-3,8-diol?
The canonical SMILES for deca-1,9-dien-4,6-diyne-3,8-diol is C=CC(O)C#CC#CC(O)C=C.
What is the InChIKey of deca-1,9-dien-4,6-diyne-3,8-diol?
The InChIKey is SONJJNXBDNWCRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-3-9(11)7-5-6-8-10(12)4-2/h3-4,9-12H,1-2H2.
What are the key properties of deca-1,9-dien-4,6-diyne-3,8-diol?
deca-1,9-dien-4,6-diyne-3,8-diol has a molecular weight of 162.19 g/mol, XLogP of 0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deca-1,9-dien-4,6-diyne-3,8-diol is sourced from PubChem (CID 10583112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).