C9H10O3 — CID 10583181
(1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 10583181) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is (1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 10583181 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (1-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1(C)C=CC=CC1=O |
| InChI | InChI=1S/C9H10O3/c1-7(10)12-9(2)6-4-3-5-8(9)11/h3-6H,1-2H3 |
| InChIKey | LBWDXFLTCORELZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |