About 2-methoxyethyl imidazole-1-carboxylate
2-methoxyethyl imidazole-1-carboxylate (PubChem CID 10583275) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-methoxyethyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl imidazole-1-carboxylate |
| PubChem CID | 10583275 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-methoxyethyl imidazole-1-carboxylate |
| SMILES | COCCOC(=O)n1ccnc1 |
| InChI | InChI=1S/C7H10N2O3/c1-11-4-5-12-7(10)9-3-2-8-6-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | SQFUIOWCOBPWPJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl imidazole-1-carboxylate?
The IUPAC name of 2-methoxyethyl imidazole-1-carboxylate (CID 10583275) is 2-methoxyethyl imidazole-1-carboxylate.
What is the SMILES notation for 2-methoxyethyl imidazole-1-carboxylate?
The canonical SMILES for 2-methoxyethyl imidazole-1-carboxylate is COCCOC(=O)n1ccnc1.
What is the InChIKey of 2-methoxyethyl imidazole-1-carboxylate?
The InChIKey is SQFUIOWCOBPWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-11-4-5-12-7(10)9-3-2-8-6-9/h2-3,6H,4-5H2,1H3.
What are the key properties of 2-methoxyethyl imidazole-1-carboxylate?
2-methoxyethyl imidazole-1-carboxylate has a molecular weight of 170.17 g/mol, XLogP of 0.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl imidazole-1-carboxylate is sourced from PubChem (CID 10583275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).