About N-prop-2-ynyl-1,3-benzoxazol-2-amine
N-prop-2-ynyl-1,3-benzoxazol-2-amine (PubChem CID 10583319) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is N-prop-2-ynyl-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | N-prop-2-ynyl-1,3-benzoxazol-2-amine |
| PubChem CID | 10583319 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | N-prop-2-ynyl-1,3-benzoxazol-2-amine |
| SMILES | C#CCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H8N2O/c1-2-7-11-10-12-8-5-3-4-6-9(8)13-10/h1,3-6H,7H2,(H,11,12) |
| InChIKey | WQKUMFCKLGKQJU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-ynyl-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-ynyl-1,3-benzoxazol-2-amine?
The IUPAC name of N-prop-2-ynyl-1,3-benzoxazol-2-amine (CID 10583319) is N-prop-2-ynyl-1,3-benzoxazol-2-amine.
What is the SMILES notation for N-prop-2-ynyl-1,3-benzoxazol-2-amine?
The canonical SMILES for N-prop-2-ynyl-1,3-benzoxazol-2-amine is C#CCNc1nc2ccccc2o1.
What is the InChIKey of N-prop-2-ynyl-1,3-benzoxazol-2-amine?
The InChIKey is WQKUMFCKLGKQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c1-2-7-11-10-12-8-5-3-4-6-9(8)13-10/h1,3-6H,7H2,(H,11,12).
What are the key properties of N-prop-2-ynyl-1,3-benzoxazol-2-amine?
N-prop-2-ynyl-1,3-benzoxazol-2-amine has a molecular weight of 172.19 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-ynyl-1,3-benzoxazol-2-amine is sourced from PubChem (CID 10583319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).