About 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile
2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile (PubChem CID 10583394) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile |
| PubChem CID | 10583394 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile |
| SMILES | N#CCC12CCCC1=CC(=O)CC2 |
| InChI | InChI=1S/C11H13NO/c12-7-6-11-4-1-2-9(11)8-10(13)3-5-11/h8H,1-6H2 |
| InChIKey | ZYNLNLKFIZKEIU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile?
The IUPAC name of 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile (CID 10583394) is 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile.
What is the SMILES notation for 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile?
The canonical SMILES for 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile is N#CCC12CCCC1=CC(=O)CC2.
What is the InChIKey of 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile?
The InChIKey is ZYNLNLKFIZKEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c12-7-6-11-4-1-2-9(11)8-10(13)3-5-11/h8H,1-6H2.
What are the key properties of 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile?
2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile has a molecular weight of 175.23 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxo-2,3,4,5-tetrahydro-1H-inden-3a-yl)acetonitrile is sourced from PubChem (CID 10583394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).