About 4-N-phenylpyridine-3,4-diamine
4-N-phenylpyridine-3,4-diamine (PubChem CID 10583675) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-N-phenylpyridine-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-phenylpyridine-3,4-diamine |
| PubChem CID | 10583675 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-N-phenylpyridine-3,4-diamine |
| SMILES | Nc1cnccc1Nc1ccccc1 |
| InChI | InChI=1S/C11H11N3/c12-10-8-13-7-6-11(10)14-9-4-2-1-3-5-9/h1-8H,12H2,(H,13,14) |
| InChIKey | FVUVDAATDDOHKA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-phenylpyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-phenylpyridine-3,4-diamine?
The IUPAC name of 4-N-phenylpyridine-3,4-diamine (CID 10583675) is 4-N-phenylpyridine-3,4-diamine.
What is the SMILES notation for 4-N-phenylpyridine-3,4-diamine?
The canonical SMILES for 4-N-phenylpyridine-3,4-diamine is Nc1cnccc1Nc1ccccc1.
What is the InChIKey of 4-N-phenylpyridine-3,4-diamine?
The InChIKey is FVUVDAATDDOHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c12-10-8-13-7-6-11(10)14-9-4-2-1-3-5-9/h1-8H,12H2,(H,13,14).
What are the key properties of 4-N-phenylpyridine-3,4-diamine?
4-N-phenylpyridine-3,4-diamine has a molecular weight of 185.23 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-phenylpyridine-3,4-diamine is sourced from PubChem (CID 10583675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).