About [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol
[(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol (PubChem CID 10583749) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol |
| PubChem CID | 10583749 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol |
| SMILES | OC[C@@H]1Cc2cc3ccccc3n2C1 |
| InChI | InChI=1S/C12H13NO/c14-8-9-5-11-6-10-3-1-2-4-12(10)13(11)7-9/h1-4,6,9,14H,5,7-8H2/t9-/m1/s1 |
| InChIKey | XBPTULRKNULCHF-SECBINFHSA-N |
| XLogP | 1.81 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol?
The IUPAC name of [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol (CID 10583749) is [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol.
What is the SMILES notation for [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol?
The canonical SMILES for [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol is OC[C@@H]1Cc2cc3ccccc3n2C1.
What is the InChIKey of [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol?
The InChIKey is XBPTULRKNULCHF-SECBINFHSA-N. The full InChI is InChI=1S/C12H13NO/c14-8-9-5-11-6-10-3-1-2-4-12(10)13(11)7-9/h1-4,6,9,14H,5,7-8H2/t9-/m1/s1.
What are the key properties of [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol?
[(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol has a molecular weight of 187.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-yl]methanol is sourced from PubChem (CID 10583749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).