C13H20O — CID 10583913
1-[(1S,3aS,6aS)-1,2,3,3a,4,6a-hexahydropentalen-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 10583913) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-[(1S,3aS,6aS)-1,2,3,3a,4,6a-hexahydropentalen-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1S,3aS,6aS)-1,2,3,3a,4,6a-hexahydropentalen-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 10583913 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-[(1S,3aS,6aS)-1,2,3,3a,4,6a-hexahydropentalen-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@H]1CC[C@H]2CC=C[C@H]21 |
| InChI | InChI=1S/C13H20O/c1-13(2,3)12(14)11-8-7-9-5-4-6-10(9)11/h4,6,9-11H,5,7-8H2,1-3H3/t9-,10-,11+/m1/s1 |
| InChIKey | OAGMUZHGERYJAJ-MXWKQRLJSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|