C12H16S — CID 10583916
1,3,4,5,6,7-hexahydro-2-benzothionine (PubChem CID 10583916) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexahydro-2-benzothionine.
| Compound Name | 1,3,4,5,6,7-hexahydro-2-benzothionine |
|---|---|
| PubChem CID | 10583916 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1,3,4,5,6,7-hexahydro-2-benzothionine |
| SMILES | c1ccc2c(c1)CCCCCSC2 |
| InChI | InChI=1S/C12H16S/c1-2-6-11-7-3-4-8-12(11)10-13-9-5-1/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChIKey | WSNPGCQLFNFJAB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |