methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate

C11H16O3 — CID 10584043

IUPACmethyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate
SMILESCOC(=O)C1=C2CCCCC2(C)OC1
InChIInChI=1S/C11H16O3/c1-11-6-4-3-5-9(11)8(7-14-11)10(12)13-2/h3-7H2,1-2H3
InChIKeyAVLGXZSPXDKELK-UHFFFAOYSA-N
MW196.25 g/mol
LogP1.82
Rot. Bonds1

About methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate

methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate (PubChem CID 10584043) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate.

Molecular Properties

Compound Namemethyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate
PubChem CID10584043
Molecular FormulaC11H16O3
Molecular Weight196.25 g/mol
Exact Mass196.11
IUPAC Namemethyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate
SMILESCOC(=O)C1=C2CCCCC2(C)OC1
InChIInChI=1S/C11H16O3/c1-11-6-4-3-5-9(11)8(7-14-11)10(12)13-2/h3-7H2,1-2H3
InChIKeyAVLGXZSPXDKELK-UHFFFAOYSA-N
XLogP1.82
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate?
The IUPAC name of methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate (CID 10584043) is methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate.
What is the SMILES notation for methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate?
The canonical SMILES for methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate is COC(=O)C1=C2CCCCC2(C)OC1.
What is the InChIKey of methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate?
The InChIKey is AVLGXZSPXDKELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-11-6-4-3-5-9(11)8(7-14-11)10(12)13-2/h3-7H2,1-2H3.
What are the key properties of methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate?
methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7a-methyl-4,5,6,7-tetrahydro-2H-1-benzofuran-3-carboxylate is sourced from PubChem (CID 10584043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).