C10H20N4 — CID 10584056
3,5,8,10-tetramethyl-3,5,8,10-tetrazatricyclo[5.3.0.02,6]decane (PubChem CID 10584056) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 3,5,8,10-tetramethyl-3,5,8,10-tetrazatricyclo[5.3.0.02,6]decane.
| Compound Name | 3,5,8,10-tetramethyl-3,5,8,10-tetrazatricyclo[5.3.0.02,6]decane |
|---|---|
| PubChem CID | 10584056 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3,5,8,10-tetramethyl-3,5,8,10-tetrazatricyclo[5.3.0.02,6]decane |
| SMILES | CN1CN(C)C2C1C1C2N(C)CN1C |
| InChI | InChI=1S/C10H20N4/c1-11-5-12(2)8-7(11)9-10(8)14(4)6-13(9)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | WCNAQZCJDSVCEL-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |