C12H24O2 — CID 10584205
(2R,3R)-7-methyl-2-prop-2-enyloctane-1,3-diol (PubChem CID 10584205) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (2R,3R)-7-methyl-2-prop-2-enyloctane-1,3-diol.
| Compound Name | (2R,3R)-7-methyl-2-prop-2-enyloctane-1,3-diol |
|---|---|
| PubChem CID | 10584205 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (2R,3R)-7-methyl-2-prop-2-enyloctane-1,3-diol |
| SMILES | C=CC[C@H](CO)[C@H](O)CCCC(C)C |
| InChI | InChI=1S/C12H24O2/c1-4-6-11(9-13)12(14)8-5-7-10(2)3/h4,10-14H,1,5-9H2,2-3H3/t11-,12-/m1/s1 |
| InChIKey | UOFQQFWLDQWRFT-VXGBXAGGSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|