About [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol
[(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol (PubChem CID 10584257) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol |
| PubChem CID | 10584257 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol |
| SMILES | COCOCC1[C@@H](CO)C=C[C@H]1CO |
| InChI | InChI=1S/C10H18O4/c1-13-7-14-6-10-8(4-11)2-3-9(10)5-12/h2-3,8-12H,4-7H2,1H3/t8-,9+,10? |
| InChIKey | NPKPDFILSTVCGL-ULKQDVFKSA-N |
| XLogP | 0.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol?
The IUPAC name of [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol (CID 10584257) is [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol.
What is the SMILES notation for [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol?
The canonical SMILES for [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol is COCOCC1[C@@H](CO)C=C[C@H]1CO.
What is the InChIKey of [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol?
The InChIKey is NPKPDFILSTVCGL-ULKQDVFKSA-N. The full InChI is InChI=1S/C10H18O4/c1-13-7-14-6-10-8(4-11)2-3-9(10)5-12/h2-3,8-12H,4-7H2,1H3/t8-,9+,10?.
What are the key properties of [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol?
[(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol has a molecular weight of 202.25 g/mol, XLogP of 0.01, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4R)-4-(hydroxymethyl)-5-(methoxymethoxymethyl)cyclopent-2-en-1-yl]methanol is sourced from PubChem (CID 10584257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).