2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid

C9H8N2O4 — CID 10584466

IUPAC2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid
SMILESO=C(O)CC1C(=O)NC(=O)c2cccn21
InChIInChI=1S/C9H8N2O4/c12-7(13)4-6-9(15)10-8(14)5-2-1-3-11(5)6/h1-3,6H,4H2,(H,12,13)(H,10,14,15)
InChIKeyLSKIBELYWJHTRB-UHFFFAOYSA-N
MW208.17 g/mol
LogP-0.23
Rot. Bonds2

About 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid

2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid (PubChem CID 10584466) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid
PubChem CID10584466
Molecular FormulaC9H8N2O4
Molecular Weight208.17 g/mol
Exact Mass208.05
IUPAC Name2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid
SMILESO=C(O)CC1C(=O)NC(=O)c2cccn21
InChIInChI=1S/C9H8N2O4/c12-7(13)4-6-9(15)10-8(14)5-2-1-3-11(5)6/h1-3,6H,4H2,(H,12,13)(H,10,14,15)
InChIKeyLSKIBELYWJHTRB-UHFFFAOYSA-N
XLogP-0.23
TPSA88.40 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.17
LogP ≤ 5-0.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid?
The IUPAC name of 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid (CID 10584466) is 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid.
What is the SMILES notation for 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid?
The canonical SMILES for 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid is O=C(O)CC1C(=O)NC(=O)c2cccn21.
What is the InChIKey of 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid?
The InChIKey is LSKIBELYWJHTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c12-7(13)4-6-9(15)10-8(14)5-2-1-3-11(5)6/h1-3,6H,4H2,(H,12,13)(H,10,14,15).
What are the key properties of 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid?
2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid has a molecular weight of 208.17 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetic acid is sourced from PubChem (CID 10584466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).