C10H12N2O3 — CID 10584470
N-[(E)-[(2S)-2,3-dihydroxypropylidene]amino]benzamide (PubChem CID 10584470) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-[(E)-[(2S)-2,3-dihydroxypropylidene]amino]benzamide.
| Compound Name | N-[(E)-[(2S)-2,3-dihydroxypropylidene]amino]benzamide |
|---|---|
| PubChem CID | 10584470 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-[(E)-[(2S)-2,3-dihydroxypropylidene]amino]benzamide |
| SMILES | O=C(N/N=C/[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O3/c13-7-9(14)6-11-12-10(15)8-4-2-1-3-5-8/h1-6,9,13-14H,7H2,(H,12,15)/b11-6+/t9-/m0/s1 |
| InChIKey | MPHYXODNUXNYKX-CAXXOGMASA-N |
| XLogP | -0.24 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|