2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid

C10H10O3S — CID 10584566

IUPAC2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid
SMILESO=C(O)CC1CCc2sccc2C1=O
InChIInChI=1S/C10H10O3S/c11-9(12)5-6-1-2-8-7(10(6)13)3-4-14-8/h3-4,6H,1-2,5H2,(H,11,12)
InChIKeySAOLNPJPCPAMSO-UHFFFAOYSA-N
MW210.25 g/mol
LogP1.97
Rot. Bonds2

About 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid

2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid (PubChem CID 10584566) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid.

Molecular Properties

Compound Name2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid
PubChem CID10584566
Molecular FormulaC10H10O3S
Molecular Weight210.25 g/mol
Exact Mass210.04
IUPAC Name2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid
SMILESO=C(O)CC1CCc2sccc2C1=O
InChIInChI=1S/C10H10O3S/c11-9(12)5-6-1-2-8-7(10(6)13)3-4-14-8/h3-4,6H,1-2,5H2,(H,11,12)
InChIKeySAOLNPJPCPAMSO-UHFFFAOYSA-N
XLogP1.97
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.25
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid?
The IUPAC name of 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid (CID 10584566) is 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid.
What is the SMILES notation for 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid?
The canonical SMILES for 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid is O=C(O)CC1CCc2sccc2C1=O.
What is the InChIKey of 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid?
The InChIKey is SAOLNPJPCPAMSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S/c11-9(12)5-6-1-2-8-7(10(6)13)3-4-14-8/h3-4,6H,1-2,5H2,(H,11,12).
What are the key properties of 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid?
2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid has a molecular weight of 210.25 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)acetic acid is sourced from PubChem (CID 10584566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).