C12H16O3 — CID 10584569
[4-[(2R,3S)-2,3-dideuterio-3-hydroxybutyl]phenyl] acetate (PubChem CID 10584569) has the molecular formula C12H16O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is [4-[(2R,3S)-2,3-dideuterio-3-hydroxybutyl]phenyl] acetate.
| Compound Name | [4-[(2R,3S)-2,3-dideuterio-3-hydroxybutyl]phenyl] acetate |
|---|---|
| PubChem CID | 10584569 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | [4-[(2R,3S)-2,3-dideuterio-3-hydroxybutyl]phenyl] acetate |
| SMILES | [2H][C@H](Cc1ccc(OC(C)=O)cc1)[C@]([2H])(C)O |
| InChI | InChI=1S/C12H16O3/c1-9(13)3-4-11-5-7-12(8-6-11)15-10(2)14/h5-9,13H,3-4H2,1-2H3/t9-/m0/s1/i3D,9D/t3-,9+/m1 |
| InChIKey | NQWRBKVDLUSZBH-FCFVHBOTSA-N |
| XLogP | 1.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|