About 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid
4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid (PubChem CID 10584661) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid |
| PubChem CID | 10584661 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid |
| SMILES | CC1(C)CCC(C(=O)CCC(=O)O)CC1 |
| InChI | InChI=1S/C12H20O3/c1-12(2)7-5-9(6-8-12)10(13)3-4-11(14)15/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | SNUKEYCZVRMXLM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid?
The IUPAC name of 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid (CID 10584661) is 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid?
The canonical SMILES for 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid is CC1(C)CCC(C(=O)CCC(=O)O)CC1.
What is the InChIKey of 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid?
The InChIKey is SNUKEYCZVRMXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-12(2)7-5-9(6-8-12)10(13)3-4-11(14)15/h9H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid?
4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid has a molecular weight of 212.29 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylcyclohexyl)-4-oxobutanoic acid is sourced from PubChem (CID 10584661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).