C10H20BNO3 — CID 10584685
1-(1,3,6,2-dioxazaborocan-2-yl)-4-methylpentan-3-one (PubChem CID 10584685) has the molecular formula C10H20BNO3 and a molecular weight of 213.09 g/mol. Its IUPAC name is 1-(1,3,6,2-dioxazaborocan-2-yl)-4-methylpentan-3-one.
| Compound Name | 1-(1,3,6,2-dioxazaborocan-2-yl)-4-methylpentan-3-one |
|---|---|
| PubChem CID | 10584685 |
| Molecular Formula | C10H20BNO3 |
| Molecular Weight | 213.09 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-(1,3,6,2-dioxazaborocan-2-yl)-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)CCB1OCCNCCO1 |
| InChI | InChI=1S/C10H20BNO3/c1-9(2)10(13)3-4-11-14-7-5-12-6-8-15-11/h9,12H,3-8H2,1-2H3 |
| InChIKey | UVEGCGYBTDLHOC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.09 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|