C11H18O4 — CID 10584730
(3S,4aR,7S,7aS)-3-ethoxy-7-hydroxy-7-methyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one (PubChem CID 10584730) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3S,4aR,7S,7aS)-3-ethoxy-7-hydroxy-7-methyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one.
| Compound Name | (3S,4aR,7S,7aS)-3-ethoxy-7-hydroxy-7-methyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one |
|---|---|
| PubChem CID | 10584730 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (3S,4aR,7S,7aS)-3-ethoxy-7-hydroxy-7-methyl-3,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-1-one |
| SMILES | CCO[C@@H]1C[C@H]2CC[C@](C)(O)[C@H]2C(=O)O1 |
| InChI | InChI=1S/C11H18O4/c1-3-14-8-6-7-4-5-11(2,13)9(7)10(12)15-8/h7-9,13H,3-6H2,1-2H3/t7-,8+,9-,11+/m1/s1 |
| InChIKey | RXWSBWAEIRXXDN-LOKLDPHHSA-N |
| XLogP | 1.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |