C9H15NO5 — CID 10584860
(6S,7S,8S,8aS)-6,7,8-trihydroxy-8a-methoxy-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 10584860) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (6S,7S,8S,8aS)-6,7,8-trihydroxy-8a-methoxy-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (6S,7S,8S,8aS)-6,7,8-trihydroxy-8a-methoxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 10584860 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (6S,7S,8S,8aS)-6,7,8-trihydroxy-8a-methoxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | CO[C@]12CCC(=O)N1C[C@H](O)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C9H15NO5/c1-15-9-3-2-6(12)10(9)4-5(11)7(13)8(9)14/h5,7-8,11,13-14H,2-4H2,1H3/t5-,7-,8-,9-/m0/s1 |
| InChIKey | UCYUNVMMPYEBEI-ZITKLIBNSA-N |
| XLogP | -1.95 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |