C14H21NO — CID 10584976
4,7-ditert-butylazepin-2-one (PubChem CID 10584976) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 4,7-ditert-butylazepin-2-one.
| Compound Name | 4,7-ditert-butylazepin-2-one |
|---|---|
| PubChem CID | 10584976 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4,7-ditert-butylazepin-2-one |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)nc(=O)c1 |
| InChI | InChI=1S/C14H21NO/c1-13(2,3)10-7-8-11(14(4,5)6)15-12(16)9-10/h7-9H,1-6H3 |
| InChIKey | OXTQNLKWUWTDRW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |