C14H20O2 — CID 10585024
[(1R,3aS,8aS)-1-methyl-4-methylidene-2,3,3a,5,6,8a-hexahydroazulen-1-yl] acetate (PubChem CID 10585024) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is [(1R,3aS,8aS)-1-methyl-4-methylidene-2,3,3a,5,6,8a-hexahydroazulen-1-yl] acetate.
| Compound Name | [(1R,3aS,8aS)-1-methyl-4-methylidene-2,3,3a,5,6,8a-hexahydroazulen-1-yl] acetate |
|---|---|
| PubChem CID | 10585024 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [(1R,3aS,8aS)-1-methyl-4-methylidene-2,3,3a,5,6,8a-hexahydroazulen-1-yl] acetate |
| SMILES | C=C1CCC=C[C@H]2[C@@H]1CC[C@@]2(C)OC(C)=O |
| InChI | InChI=1S/C14H20O2/c1-10-6-4-5-7-13-12(10)8-9-14(13,3)16-11(2)15/h5,7,12-13H,1,4,6,8-9H2,2-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | VUGISWSUOFEMJV-HZSPNIEDSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|