About 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium
3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium (PubChem CID 10585475) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium.
Molecular Properties
| Compound Name | 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium |
| PubChem CID | 10585475 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium |
| SMILES | Cc1nc(Cl)c(C)[n+]([O-])c1CCC(C)C |
| InChI | InChI=1S/C11H17ClN2O/c1-7(2)5-6-10-8(3)13-11(12)9(4)14(10)15/h7H,5-6H2,1-4H3 |
| InChIKey | GDIMWNHCPIUQLE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium?
The IUPAC name of 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium (CID 10585475) is 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium.
What is the SMILES notation for 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium?
The canonical SMILES for 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium is Cc1nc(Cl)c(C)[n+]([O-])c1CCC(C)C.
What is the InChIKey of 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium?
The InChIKey is GDIMWNHCPIUQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2O/c1-7(2)5-6-10-8(3)13-11(12)9(4)14(10)15/h7H,5-6H2,1-4H3.
What are the key properties of 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium?
3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium has a molecular weight of 228.72 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5-dimethyl-6-(3-methylbutyl)-1-oxidopyrazin-1-ium is sourced from PubChem (CID 10585475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).