C15H18O2 — CID 10585555
(8aR,9aS)-3,5,8a-trimethyl-7,8,9,9a-tetrahydrobenzo[f][1]benzofuran-2-one (PubChem CID 10585555) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (8aR,9aS)-3,5,8a-trimethyl-7,8,9,9a-tetrahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (8aR,9aS)-3,5,8a-trimethyl-7,8,9,9a-tetrahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 10585555 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (8aR,9aS)-3,5,8a-trimethyl-7,8,9,9a-tetrahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCC[C@]2(C)C[C@@H]3OC(=O)C(C)=C3C=C12 |
| InChI | InChI=1S/C15H18O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h5,7,13H,4,6,8H2,1-3H3/t13-,15+/m0/s1 |
| InChIKey | VHISVHAVHXVFES-DZGCQCFKSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |