C16H22O — CID 10585573
(5E,7E)-2,2-dimethyl-8-phenylocta-5,7-dien-3-ol (PubChem CID 10585573) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (5E,7E)-2,2-dimethyl-8-phenylocta-5,7-dien-3-ol.
| Compound Name | (5E,7E)-2,2-dimethyl-8-phenylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 10585573 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (5E,7E)-2,2-dimethyl-8-phenylocta-5,7-dien-3-ol |
| SMILES | CC(C)(C)C(O)C/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-16(2,3)15(17)13-9-5-8-12-14-10-6-4-7-11-14/h4-12,15,17H,13H2,1-3H3/b9-5+,12-8+ |
| InChIKey | ZUUYQDRSDOBXOB-PIHCAMFYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|