C13H19NO3 — CID 10585952
(3aR,9aR)-5a-hydroxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one (PubChem CID 10585952) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3aR,9aR)-5a-hydroxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one.
| Compound Name | (3aR,9aR)-5a-hydroxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one |
|---|---|
| PubChem CID | 10585952 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3aR,9aR)-5a-hydroxy-2-prop-2-enyl-3a,4,6,7,8,9-hexahydro-3H-[1]benzofuro[3,3a-c]pyrrol-1-one |
| SMILES | C=CCN1C[C@@H]2COC3(O)CCCC[C@@]23C1=O |
| InChI | InChI=1S/C13H19NO3/c1-2-7-14-8-10-9-17-13(16)6-4-3-5-12(10,13)11(14)15/h2,10,16H,1,3-9H2/t10-,12+,13?/m1/s1 |
| InChIKey | WSVHKYYTDKQZJK-FVBASEICSA-N |
| XLogP | 0.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|