About 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline
5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline (PubChem CID 10586086) has the molecular formula C15H17N3
and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline.
Molecular Properties
| Compound Name | 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline |
| PubChem CID | 10586086 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline |
| SMILES | C1=C(CCCn2ccnc2)c2cccnc2CC1 |
| InChI | InChI=1S/C15H17N3/c1-4-13(5-3-10-18-11-9-16-12-18)14-6-2-8-17-15(14)7-1/h2,4,6,8-9,11-12H,1,3,5,7,10H2 |
| InChIKey | JHKBLBMCCJQROB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline?
The IUPAC name of 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline (CID 10586086) is 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline.
What is the SMILES notation for 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline?
The canonical SMILES for 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline is C1=C(CCCn2ccnc2)c2cccnc2CC1.
What is the InChIKey of 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline?
The InChIKey is JHKBLBMCCJQROB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3/c1-4-13(5-3-10-18-11-9-16-12-18)14-6-2-8-17-15(14)7-1/h2,4,6,8-9,11-12H,1,3,5,7,10H2.
What are the key properties of 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline?
5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline has a molecular weight of 239.32 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-imidazol-1-ylpropyl)-7,8-dihydroquinoline is sourced from PubChem (CID 10586086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).