C9H12N4O2S — CID 10586124
8-ethylsulfanyl-3,9-dimethylpurine-2,6-dione (PubChem CID 10586124) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 8-ethylsulfanyl-3,9-dimethylpurine-2,6-dione.
| Compound Name | 8-ethylsulfanyl-3,9-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 10586124 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 8-ethylsulfanyl-3,9-dimethylpurine-2,6-dione |
| SMILES | CCSc1nc2c(=O)[nH]c(=O)n(C)c2n1C |
| InChI | InChI=1S/C9H12N4O2S/c1-4-16-9-10-5-6(14)11-8(15)12(2)7(5)13(9)3/h4H2,1-3H3,(H,11,14,15) |
| InChIKey | JENWCFOAZNOTFX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |