C11H14O6 — CID 10586221
methyl (1S,2R,3S,4S,6R,7R)-4-formyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-3-carboxylate (PubChem CID 10586221) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl (1S,2R,3S,4S,6R,7R)-4-formyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-3-carboxylate.
| Compound Name | methyl (1S,2R,3S,4S,6R,7R)-4-formyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-3-carboxylate |
|---|---|
| PubChem CID | 10586221 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl (1S,2R,3S,4S,6R,7R)-4-formyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@@H](C[C@@H]1C=O)[C@H]1OO[C@]2(C)O1 |
| InChI | InChI=1S/C11H14O6/c1-11-8-6(10(15-11)16-17-11)3-5(4-12)7(8)9(13)14-2/h4-8,10H,3H2,1-2H3/t5-,6-,7+,8-,10-,11+/m1/s1 |
| InChIKey | YMTIDRUNMZGPRB-CXRJXMPQSA-N |
| XLogP | 0.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|