methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate

C12H24O3Si — CID 10586421

IUPACmethyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate
SMILESCOC(=O)C1CC(C)O[Si]1(C(C)C)C(C)C
InChIInChI=1S/C12H24O3Si/c1-8(2)16(9(3)4)11(12(13)14-6)7-10(5)15-16/h8-11H,7H2,1-6H3
InChIKeyCHUDEQWWLMRZQG-UHFFFAOYSA-N
MW244.41 g/mol
LogP3.10
Rot. Bonds3

About methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate

methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate (PubChem CID 10586421) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate
PubChem CID10586421
Molecular FormulaC12H24O3Si
Molecular Weight244.41 g/mol
Exact Mass244.15
IUPAC Namemethyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate
SMILESCOC(=O)C1CC(C)O[Si]1(C(C)C)C(C)C
InChIInChI=1S/C12H24O3Si/c1-8(2)16(9(3)4)11(12(13)14-6)7-10(5)15-16/h8-11H,7H2,1-6H3
InChIKeyCHUDEQWWLMRZQG-UHFFFAOYSA-N
XLogP3.10
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.41
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
The IUPAC name of methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate (CID 10586421) is methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate.
What is the SMILES notation for methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
The canonical SMILES for methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate is COC(=O)C1CC(C)O[Si]1(C(C)C)C(C)C.
What is the InChIKey of methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
The InChIKey is CHUDEQWWLMRZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3Si/c1-8(2)16(9(3)4)11(12(13)14-6)7-10(5)15-16/h8-11H,7H2,1-6H3.
What are the key properties of methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate?
methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate has a molecular weight of 244.41 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-2,2-di(propan-2-yl)oxasilolane-3-carboxylate is sourced from PubChem (CID 10586421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).