About 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one
2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one (PubChem CID 10586445) has the molecular formula C11H7N3O2S
and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one |
| PubChem CID | 10586445 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(Nc2nccs2)nc2ccccc12 |
| InChI | InChI=1S/C11H7N3O2S/c15-9-7-3-1-2-4-8(7)13-10(16-9)14-11-12-5-6-17-11/h1-6H,(H,12,13,14) |
| InChIKey | UIQADKIQCPHBQD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one?
The IUPAC name of 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one (CID 10586445) is 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one?
The canonical SMILES for 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one is O=c1oc(Nc2nccs2)nc2ccccc12.
What is the InChIKey of 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one?
The InChIKey is UIQADKIQCPHBQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2S/c15-9-7-3-1-2-4-8(7)13-10(16-9)14-11-12-5-6-17-11/h1-6H,(H,12,13,14).
What are the key properties of 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one?
2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one has a molecular weight of 245.26 g/mol, XLogP of 2.39, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-ylamino)-3,1-benzoxazin-4-one is sourced from PubChem (CID 10586445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).