C14H20O4 — CID 10586909
5-[2-(cyclopenten-1-yl)-2-hydroxyethyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 10586909) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-[2-(cyclopenten-1-yl)-2-hydroxyethyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[2-(cyclopenten-1-yl)-2-hydroxyethyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10586909 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 5-[2-(cyclopenten-1-yl)-2-hydroxyethyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CC1=C(CC(O)C2=CCCC2)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C14H20O4/c1-9-11(13(16)18-14(2,3)17-9)8-12(15)10-6-4-5-7-10/h6,12,15H,4-5,7-8H2,1-3H3 |
| InChIKey | IBAJEAMVSHYMBV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|