C14H20O4 — CID 10586911
methyl (3aS,3bR,6aR,7aS)-5,5-dimethyl-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate (PubChem CID 10586911) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl (3aS,3bR,6aR,7aS)-5,5-dimethyl-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate.
| Compound Name | methyl (3aS,3bR,6aR,7aS)-5,5-dimethyl-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
|---|---|
| PubChem CID | 10586911 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl (3aS,3bR,6aR,7aS)-5,5-dimethyl-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
| SMILES | COC(=O)[C@]12CC(C)(C)C[C@H]1C[C@@H]1C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C14H20O4/c1-13(2)5-8-4-9-10(6-18-11(9)15)14(8,7-13)12(16)17-3/h8-10H,4-7H2,1-3H3/t8-,9+,10+,14-/m1/s1 |
| InChIKey | BIEHVPCANXSAKH-MAGOMRGPSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |