C16H28O2 — CID 10586941
cis-(13R,14S)-13,14-dimethyl-11-methylidene-oxacyclotetradecan-2-one (PubChem CID 10586941) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is cis-(13R,14S)-13,14-dimethyl-11-methylidene-oxacyclotetradecan-2-one.
| Compound Name | cis-(13R,14S)-13,14-dimethyl-11-methylidene-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 10586941 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | cis-(13R,14S)-13,14-dimethyl-11-methylidene-oxacyclotetradecan-2-one |
| SMILES | C=C1CCCCCCCCC(=O)O[C@@H](C)[C@H](C)C1 |
| InChI | InChI=1S/C16H28O2/c1-13-10-8-6-4-5-7-9-11-16(17)18-15(3)14(2)12-13/h14-15H,1,4-12H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | FWJWWLVFUUDKAC-CABCVRRESA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|