C11H9Cl2N3 — CID 10587009
1-[2-(2,4-dichlorophenyl)prop-2-enyl]-1,2,4-triazole (PubChem CID 10587009) has the molecular formula C11H9Cl2N3 and a molecular weight of 254.12 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)prop-2-enyl]-1,2,4-triazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)prop-2-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10587009 |
| Molecular Formula | C11H9Cl2N3 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)prop-2-enyl]-1,2,4-triazole |
| SMILES | C=C(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N3/c1-8(5-16-7-14-6-15-16)10-3-2-9(12)4-11(10)13/h2-4,6-7H,1,5H2 |
| InChIKey | LIGQIKWAURBLAJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |