About 4-(1,3,2-dithiarsolan-2-yl)aniline
4-(1,3,2-dithiarsolan-2-yl)aniline (PubChem CID 10587351) has the molecular formula C8H10AsNS2
and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-(1,3,2-dithiarsolan-2-yl)aniline.
Molecular Properties
| Compound Name | 4-(1,3,2-dithiarsolan-2-yl)aniline |
| PubChem CID | 10587351 |
| Molecular Formula | C8H10AsNS2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 4-(1,3,2-dithiarsolan-2-yl)aniline |
| SMILES | Nc1ccc([As]2SCCS2)cc1 |
| InChI | InChI=1S/C8H10AsNS2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4H,5-6,10H2 |
| InChIKey | PKKPMJCHFYSKJC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3,2-dithiarsolan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,2-dithiarsolan-2-yl)aniline?
The IUPAC name of 4-(1,3,2-dithiarsolan-2-yl)aniline (CID 10587351) is 4-(1,3,2-dithiarsolan-2-yl)aniline.
What is the SMILES notation for 4-(1,3,2-dithiarsolan-2-yl)aniline?
The canonical SMILES for 4-(1,3,2-dithiarsolan-2-yl)aniline is Nc1ccc([As]2SCCS2)cc1.
What is the InChIKey of 4-(1,3,2-dithiarsolan-2-yl)aniline?
The InChIKey is PKKPMJCHFYSKJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10AsNS2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4H,5-6,10H2.
What are the key properties of 4-(1,3,2-dithiarsolan-2-yl)aniline?
4-(1,3,2-dithiarsolan-2-yl)aniline has a molecular weight of 259.23 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,2-dithiarsolan-2-yl)aniline is sourced from PubChem (CID 10587351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).