C20H20 — CID 10587445
(3Z,12Z)-tricyclo[13.3.1.16,10]icosa-1(19),3,6(20),7,9,12,15,17-octaene (PubChem CID 10587445) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is (3Z,12Z)-tricyclo[13.3.1.16,10]icosa-1(19),3,6(20),7,9,12,15,17-octaene.
| Compound Name | (3Z,12Z)-tricyclo[13.3.1.16,10]icosa-1(19),3,6(20),7,9,12,15,17-octaene |
|---|---|
| PubChem CID | 10587445 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (3Z,12Z)-tricyclo[13.3.1.16,10]icosa-1(19),3,6(20),7,9,12,15,17-octaene |
| SMILES | C1=C\Cc2cccc(c2)C/C=C\Cc2cccc(c2)C/1 |
| InChI | InChI=1S/C20H20/c1-2-8-18-12-6-14-20(16-18)10-4-3-9-19-13-5-11-17(7-1)15-19/h1-6,11-16H,7-10H2/b2-1-,4-3- |
| InChIKey | AHCDQLBWPWTVGX-LOKDLIDFSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|