C15H18O4 — CID 10587551
(1aS,2S,2aS,4R,5aS,6aR)-2,2a-dimethyl-4'-methylidenespiro[1a,2,5,5a,6,6a-hexahydroindeno[5,6-b]oxirene-4,3'-oxolane]-2',3-dione (PubChem CID 10587551) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1aS,2S,2aS,4R,5aS,6aR)-2,2a-dimethyl-4'-methylidenespiro[1a,2,5,5a,6,6a-hexahydroindeno[5,6-b]oxirene-4,3'-oxolane]-2',3-dione.
| Compound Name | (1aS,2S,2aS,4R,5aS,6aR)-2,2a-dimethyl-4'-methylidenespiro[1a,2,5,5a,6,6a-hexahydroindeno[5,6-b]oxirene-4,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 10587551 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1aS,2S,2aS,4R,5aS,6aR)-2,2a-dimethyl-4'-methylidenespiro[1a,2,5,5a,6,6a-hexahydroindeno[5,6-b]oxirene-4,3'-oxolane]-2',3-dione |
| SMILES | C=C1COC(=O)[C@]12C[C@H]1C[C@H]3O[C@H]3[C@@H](C)[C@@]1(C)C2=O |
| InChI | InChI=1S/C15H18O4/c1-7-6-18-13(17)15(7)5-9-4-10-11(19-10)8(2)14(9,3)12(15)16/h8-11H,1,4-6H2,2-3H3/t8-,9-,10-,11+,14-,15-/m1/s1 |
| InChIKey | SPBCKMSFLJUBDT-HXQJMZMJSA-N |
| XLogP | 1.49 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|