C15H22O4 — CID 10587831
methyl (1S,3aR,6R,6aR)-6-(2-methyl-1,3-dioxolan-2-yl)-3-methylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate (PubChem CID 10587831) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (1S,3aR,6R,6aR)-6-(2-methyl-1,3-dioxolan-2-yl)-3-methylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate.
| Compound Name | methyl (1S,3aR,6R,6aR)-6-(2-methyl-1,3-dioxolan-2-yl)-3-methylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 10587831 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (1S,3aR,6R,6aR)-6-(2-methyl-1,3-dioxolan-2-yl)-3-methylidene-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
| SMILES | C=C1C[C@H](C(=O)OC)[C@H]2[C@H](C3(C)OCCO3)CC[C@@H]12 |
| InChI | InChI=1S/C15H22O4/c1-9-8-11(14(16)17-3)13-10(9)4-5-12(13)15(2)18-6-7-19-15/h10-13H,1,4-8H2,2-3H3/t10-,11-,12+,13-/m0/s1 |
| InChIKey | COFIAGWSWFSVKM-RVMXOQNASA-N |
| XLogP | 2.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|