C16H28O3 — CID 10587987
(2R,3aS,6aR)-2-decyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 10587987) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2R,3aS,6aR)-2-decyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
| Compound Name | (2R,3aS,6aR)-2-decyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 10587987 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (2R,3aS,6aR)-2-decyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
| SMILES | CCCCCCCCCC[C@@H]1C[C@H]2CC(=O)O[C@H]2O1 |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-5-6-7-8-9-10-14-11-13-12-15(17)19-16(13)18-14/h13-14,16H,2-12H2,1H3/t13-,14+,16+/m0/s1 |
| InChIKey | JIZACMWQODXUPV-SQWLQELKSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|